C14H18O7S — CID 22263444
3-(3,3-dimethylbutan-2-yloxycarbonyl)-5-sulfobenzoic acid (PubChem CID 22263444) has the molecular formula C14H18O7S and a molecular weight of 330.36 g/mol. Its IUPAC name is 3-(3,3-dimethylbutan-2-yloxycarbonyl)-5-sulfobenzoic acid.
| Compound Name | 3-(3,3-dimethylbutan-2-yloxycarbonyl)-5-sulfobenzoic acid |
|---|---|
| PubChem CID | 22263444 |
| Molecular Formula | C14H18O7S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-(3,3-dimethylbutan-2-yloxycarbonyl)-5-sulfobenzoic acid |
| SMILES | CC(OC(=O)c1cc(C(=O)O)cc(S(=O)(=O)O)c1)C(C)(C)C |
| InChI | InChI=1S/C14H18O7S/c1-8(14(2,3)4)21-13(17)10-5-9(12(15)16)6-11(7-10)22(18,19)20/h5-8H,1-4H3,(H,15,16)(H,18,19,20) |
| InChIKey | KESFABZPPSYPPX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|