C16H28O7P2S — CID 141238931
3,5-bis[(tetramethyl-λ5-phosphanyl)oxycarbonyl]benzenesulfonic acid (PubChem CID 141238931) has the molecular formula C16H28O7P2S and a molecular weight of 426.41 g/mol. Its IUPAC name is 3,5-bis[(tetramethyl-λ5-phosphanyl)oxycarbonyl]benzenesulfonic acid.
| Compound Name | 3,5-bis[(tetramethyl-λ5-phosphanyl)oxycarbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 141238931 |
| Molecular Formula | C16H28O7P2S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3,5-bis[(tetramethyl-λ5-phosphanyl)oxycarbonyl]benzenesulfonic acid |
| SMILES | CP(C)(C)(C)OC(=O)c1cc(C(=O)OP(C)(C)(C)C)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H28O7P2S/c1-24(2,3,4)22-15(17)12-9-13(11-14(10-12)26(19,20)21)16(18)23-25(5,6,7)8/h9-11H,1-8H3,(H,19,20,21) |
| InChIKey | OOHVGKHXDDXXOL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|