C14H16F2O9S — CID 121444704
3,5-bis[(3-fluoro-3-hydroxypropoxy)carbonyl]benzenesulfonic acid (PubChem CID 121444704) has the molecular formula C14H16F2O9S and a molecular weight of 398.34 g/mol. Its IUPAC name is 3,5-bis[(3-fluoro-3-hydroxypropoxy)carbonyl]benzenesulfonic acid.
| Compound Name | 3,5-bis[(3-fluoro-3-hydroxypropoxy)carbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 121444704 |
| Molecular Formula | C14H16F2O9S |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 3,5-bis[(3-fluoro-3-hydroxypropoxy)carbonyl]benzenesulfonic acid |
| SMILES | O=C(OCCC(O)F)c1cc(C(=O)OCCC(O)F)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H16F2O9S/c15-11(17)1-3-24-13(19)8-5-9(7-10(6-8)26(21,22)23)14(20)25-4-2-12(16)18/h5-7,11-12,17-18H,1-4H2,(H,21,22,23) |
| InChIKey | LHKUQBSQDQPVLO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|