C12H13O9S- — CID 18798115
3-[2-(2-hydroxyethoxy)ethoxycarbonyl]-5-sulfobenzoate (PubChem CID 18798115) has the molecular formula C12H13O9S- and a molecular weight of 333.29 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethoxy)ethoxycarbonyl]-5-sulfobenzoate.
| Compound Name | 3-[2-(2-hydroxyethoxy)ethoxycarbonyl]-5-sulfobenzoate |
|---|---|
| PubChem CID | 18798115 |
| Molecular Formula | C12H13O9S- |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 3-[2-(2-hydroxyethoxy)ethoxycarbonyl]-5-sulfobenzoate |
| SMILES | O=C([O-])c1cc(C(=O)OCCOCCO)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C12H14O9S/c13-1-2-20-3-4-21-12(16)9-5-8(11(14)15)6-10(7-9)22(17,18)19/h5-7,13H,1-4H2,(H,14,15)(H,17,18,19)/p-1 |
| InChIKey | PCUOTSVILHSTDT-UHFFFAOYSA-M |
| XLogP | -1.54 |
| TPSA | 150.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|