C43H55O15PS — CID 159438976
3,5-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]benzenesulfonate;methyl(triphenyl)phosphanium (PubChem CID 159438976) has the molecular formula C43H55O15PS and a molecular weight of 874.94 g/mol. Its IUPAC name is 3,5-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]benzenesulfonate;methyl(triphenyl)phosphanium.
| Compound Name | 3,5-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]benzenesulfonate;methyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 159438976 |
| Molecular Formula | C43H55O15PS |
| Molecular Weight | 874.94 g/mol |
| Exact Mass | 874.30 |
| IUPAC Name | 3,5-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]benzenesulfonate;methyl(triphenyl)phosphanium |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C(OCCOCCOCCOCCO)c1cc(C(=O)OCCOCCOCCOCCO)cc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C24H38O15S.C19H18P/c25-1-3-32-5-7-34-9-11-36-13-15-38-23(27)20-17-21(19-22(18-20)40(29,30)31)24(28)39-16-14-37-12-10-35-8-6-33-4-2-26;1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h17-19,25-26H,1-16H2,(H,29,30,31);2-16H,1H3/q;+1/p-1 |
| InChIKey | LRXVZYLFBQBUOZ-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 205.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.94 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|