C33H35O9PS — CID 160726005
3,5-bis(2-hydroxypropoxycarbonyl)benzenesulfonate;methyl(triphenyl)phosphanium (PubChem CID 160726005) has the molecular formula C33H35O9PS and a molecular weight of 638.67 g/mol. Its IUPAC name is 3,5-bis(2-hydroxypropoxycarbonyl)benzenesulfonate;methyl(triphenyl)phosphanium.
| Compound Name | 3,5-bis(2-hydroxypropoxycarbonyl)benzenesulfonate;methyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 160726005 |
| Molecular Formula | C33H35O9PS |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 3,5-bis(2-hydroxypropoxycarbonyl)benzenesulfonate;methyl(triphenyl)phosphanium |
| SMILES | CC(O)COC(=O)c1cc(C(=O)OCC(C)O)cc(S(=O)(=O)[O-])c1.C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18P.C14H18O9S/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-8(15)6-22-13(17)10-3-11(14(18)23-7-9(2)16)5-12(4-10)24(19,20)21/h2-16H,1H3;3-5,8-9,15-16H,6-7H2,1-2H3,(H,19,20,21)/q+1;/p-1 |
| InChIKey | RTSHWISIZAYERG-UHFFFAOYSA-M |
| XLogP | 3.28 |
| TPSA | 150.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|