C35H39O11PS — CID 159798659
3,5-bis[2-(2-hydroxyethoxy)ethoxycarbonyl]benzenesulfonate;methyl(triphenyl)phosphanium (PubChem CID 159798659) has the molecular formula C35H39O11PS and a molecular weight of 698.73 g/mol. Its IUPAC name is 3,5-bis[2-(2-hydroxyethoxy)ethoxycarbonyl]benzenesulfonate;methyl(triphenyl)phosphanium.
| Compound Name | 3,5-bis[2-(2-hydroxyethoxy)ethoxycarbonyl]benzenesulfonate;methyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 159798659 |
| Molecular Formula | C35H39O11PS |
| Molecular Weight | 698.73 g/mol |
| Exact Mass | 698.20 |
| IUPAC Name | 3,5-bis[2-(2-hydroxyethoxy)ethoxycarbonyl]benzenesulfonate;methyl(triphenyl)phosphanium |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C(OCCOCCO)c1cc(C(=O)OCCOCCO)cc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C19H18P.C16H22O11S/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;17-1-3-24-5-7-26-15(19)12-9-13(11-14(10-12)28(21,22)23)16(20)27-8-6-25-4-2-18/h2-16H,1H3;9-11,17-18H,1-8H2,(H,21,22,23)/q+1;/p-1 |
| InChIKey | NJMPPEXDSUCFKJ-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|