C20H29O13S- — CID 58982223
3,5-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethoxycarbonyl]benzenesulfonate (PubChem CID 58982223) has the molecular formula C20H29O13S- and a molecular weight of 509.51 g/mol. Its IUPAC name is 3,5-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethoxycarbonyl]benzenesulfonate.
| Compound Name | 3,5-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethoxycarbonyl]benzenesulfonate |
|---|---|
| PubChem CID | 58982223 |
| Molecular Formula | C20H29O13S- |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 3,5-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethoxycarbonyl]benzenesulfonate |
| SMILES | O=C(OCCOCCOCCO)c1cc(C(=O)OCCOCCOCCO)cc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C20H30O13S/c21-1-3-28-5-7-30-9-11-32-19(23)16-13-17(15-18(14-16)34(25,26)27)20(24)33-12-10-31-8-6-29-4-2-22/h13-15,21-22H,1-12H2,(H,25,26,27)/p-1 |
| InChIKey | WFQADULVDAPREM-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|