C36H34O9PS+ — CID 87592821
3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonic acid;tetraphenylphosphanium (PubChem CID 87592821) has the molecular formula C36H34O9PS+ and a molecular weight of 673.70 g/mol. Its IUPAC name is 3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonic acid;tetraphenylphosphanium.
| Compound Name | 3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonic acid;tetraphenylphosphanium |
|---|---|
| PubChem CID | 87592821 |
| Molecular Formula | C36H34O9PS+ |
| Molecular Weight | 673.70 g/mol |
| Exact Mass | 673.17 |
| IUPAC Name | 3,5-bis(2-hydroxyethoxycarbonyl)benzenesulfonic acid;tetraphenylphosphanium |
| SMILES | O=C(OCCO)c1cc(C(=O)OCCO)cc(S(=O)(=O)O)c1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.C12H14O9S/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;13-1-3-20-11(15)8-5-9(12(16)21-4-2-14)7-10(6-8)22(17,18)19/h1-20H;5-7,13-14H,1-4H2,(H,17,18,19)/q+1; |
| InChIKey | YRUPCSWZCGCUJC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|