C36H36NO10S+ — CID 175170721
2-(2-hydroxyethoxy)ethanol;5-sulfobenzene-1,3-dicarboxylic acid;tetraphenylazanium (PubChem CID 175170721) has the molecular formula C36H36NO10S+ and a molecular weight of 674.75 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;5-sulfobenzene-1,3-dicarboxylic acid;tetraphenylazanium.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;5-sulfobenzene-1,3-dicarboxylic acid;tetraphenylazanium |
|---|---|
| PubChem CID | 175170721 |
| Molecular Formula | C36H36NO10S+ |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;5-sulfobenzene-1,3-dicarboxylic acid;tetraphenylazanium |
| SMILES | O=C(O)c1cc(C(=O)O)cc(S(=O)(=O)O)c1.OCCOCCO.c1ccc([N+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N.C8H6O7S.C4H10O3/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;9-7(10)4-1-5(8(11)12)3-6(2-4)16(13,14)15;5-1-3-7-4-2-6/h1-20H;1-3H,(H,9,10)(H,11,12)(H,13,14,15);5-6H,1-4H2/q+1;; |
| InChIKey | FLUMLVLNIHAWKC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|