C33H28O7PS+ — CID 87433999
benzyl(triphenyl)phosphanium;5-sulfobenzene-1,3-dicarboxylic acid (PubChem CID 87433999) has the molecular formula C33H28O7PS+ and a molecular weight of 599.62 g/mol. Its IUPAC name is benzyl(triphenyl)phosphanium;5-sulfobenzene-1,3-dicarboxylic acid.
| Compound Name | benzyl(triphenyl)phosphanium;5-sulfobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87433999 |
| Molecular Formula | C33H28O7PS+ |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.13 |
| IUPAC Name | benzyl(triphenyl)phosphanium;5-sulfobenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(S(=O)(=O)O)c1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P.C8H6O7S/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;9-7(10)4-1-5(8(11)12)3-6(2-4)16(13,14)15/h1-20H,21H2;1-3H,(H,9,10)(H,11,12)(H,13,14,15)/q+1; |
| InChIKey | VEAMMIALWLRORZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|