About arsane;benzyl(triphenyl)phosphanium;chloride
arsane;benzyl(triphenyl)phosphanium;chloride (PubChem CID 174558543) has the molecular formula C25H25AsClP
and a molecular weight of 466.82 g/mol. Its IUPAC name is arsane;benzyl(triphenyl)phosphanium;chloride.
Molecular Properties
| Compound Name | arsane;benzyl(triphenyl)phosphanium;chloride |
| PubChem CID | 174558543 |
| Molecular Formula | C25H25AsClP |
| Molecular Weight | 466.82 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | arsane;benzyl(triphenyl)phosphanium;chloride |
| SMILES | [AsH3].[Cl-].c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P.AsH3.ClH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;;/h1-20H,21H2;1H3;1H/q+1;;/p-1 |
| InChIKey | XISBLCKYFWSJDP-UHFFFAOYSA-M |
| XLogP | 1.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.82 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze arsane;benzyl(triphenyl)phosphanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of arsane;benzyl(triphenyl)phosphanium;chloride?
The IUPAC name of arsane;benzyl(triphenyl)phosphanium;chloride (CID 174558543) is arsane;benzyl(triphenyl)phosphanium;chloride.
What is the SMILES notation for arsane;benzyl(triphenyl)phosphanium;chloride?
The canonical SMILES for arsane;benzyl(triphenyl)phosphanium;chloride is [AsH3].[Cl-].c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of arsane;benzyl(triphenyl)phosphanium;chloride?
The InChIKey is XISBLCKYFWSJDP-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H22P.AsH3.ClH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;;/h1-20H,21H2;1H3;1H/q+1;;/p-1.
What are the key properties of arsane;benzyl(triphenyl)phosphanium;chloride?
arsane;benzyl(triphenyl)phosphanium;chloride has a molecular weight of 466.82 g/mol, XLogP of 1.00, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for arsane;benzyl(triphenyl)phosphanium;chloride is sourced from PubChem (CID 174558543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).