C64H52P2+2 — CID 90305713
[4-[(E)-1,2-diphenyl-2-[4-(triphenylphosphaniumylmethyl)phenyl]ethenyl]phenyl]methyl-triphenylphosphanium (PubChem CID 90305713) has the molecular formula C64H52P2+2 and a molecular weight of 883.07 g/mol. Its IUPAC name is [4-[(E)-1,2-diphenyl-2-[4-(triphenylphosphaniumylmethyl)phenyl]ethenyl]phenyl]methyl-triphenylphosphanium.
| Compound Name | [4-[(E)-1,2-diphenyl-2-[4-(triphenylphosphaniumylmethyl)phenyl]ethenyl]phenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 90305713 |
| Molecular Formula | C64H52P2+2 |
| Molecular Weight | 883.07 g/mol |
| Exact Mass | 882.35 |
| IUPAC Name | [4-[(E)-1,2-diphenyl-2-[4-(triphenylphosphaniumylmethyl)phenyl]ethenyl]phenyl]methyl-triphenylphosphanium |
| SMILES | c1ccc(/C(=C(/c2ccccc2)c2ccc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c2ccc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C64H52P2/c1-9-25-53(26-10-1)63(55-45-41-51(42-46-55)49-65(57-29-13-3-14-30-57,58-31-15-4-16-32-58)59-33-17-5-18-34-59)64(54-27-11-2-12-28-54)56-47-43-52(44-48-56)50-66(60-35-19-6-20-36-60,61-37-21-7-22-38-61)62-39-23-8-24-40-62/h1-48H,49-50H2/q+2/b64-63+ |
| InChIKey | OKQCGACBQBLXNT-ZOPJMJKSSA-N |
| XLogP | 13.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.07 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|