C53H46Br2OP2 — CID 45104023
(4-methylphenyl)-[[4-[4-[[(4-methylphenyl)-diphenylphosphaniumyl]methyl]benzoyl]phenyl]methyl]-diphenylphosphanium dibromide (PubChem CID 45104023) has the molecular formula C53H46Br2OP2 and a molecular weight of 920.71 g/mol. Its IUPAC name is (4-methylphenyl)-[[4-[4-[[(4-methylphenyl)-diphenylphosphaniumyl]methyl]benzoyl]phenyl]methyl]-diphenylphosphanium dibromide.
| Compound Name | (4-methylphenyl)-[[4-[4-[[(4-methylphenyl)-diphenylphosphaniumyl]methyl]benzoyl]phenyl]methyl]-diphenylphosphanium dibromide |
|---|---|
| PubChem CID | 45104023 |
| Molecular Formula | C53H46Br2OP2 |
| Molecular Weight | 920.71 g/mol |
| Exact Mass | 918.14 |
| IUPAC Name | (4-methylphenyl)-[[4-[4-[[(4-methylphenyl)-diphenylphosphaniumyl]methyl]benzoyl]phenyl]methyl]-diphenylphosphanium dibromide |
| SMILES | Cc1ccc([P+](Cc2ccc(C(=O)c3ccc(C[P+](c4ccccc4)(c4ccccc4)c4ccc(C)cc4)cc3)cc2)(c2ccccc2)c2ccccc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C53H46OP2.2BrH/c1-41-23-35-51(36-24-41)55(47-15-7-3-8-16-47,48-17-9-4-10-18-48)39-43-27-31-45(32-28-43)53(54)46-33-29-44(30-34-46)40-56(49-19-11-5-12-20-49,50-21-13-6-14-22-50)52-37-25-42(2)26-38-52;;/h3-38H,39-40H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | BUVFSAGJJCMZHC-UHFFFAOYSA-L |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|