C33H37O4P — CID 23192651
acetic acid;tris(3-methylphenyl)-[(4-methylphenyl)methyl]phosphanium;acetate (PubChem CID 23192651) has the molecular formula C33H37O4P and a molecular weight of 528.63 g/mol. Its IUPAC name is acetic acid;tris(3-methylphenyl)-[(4-methylphenyl)methyl]phosphanium;acetate.
| Compound Name | acetic acid;tris(3-methylphenyl)-[(4-methylphenyl)methyl]phosphanium;acetate |
|---|---|
| PubChem CID | 23192651 |
| Molecular Formula | C33H37O4P |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | acetic acid;tris(3-methylphenyl)-[(4-methylphenyl)methyl]phosphanium;acetate |
| SMILES | CC(=O)O.CC(=O)[O-].Cc1ccc(C[P+](c2cccc(C)c2)(c2cccc(C)c2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C29H30P.2C2H4O2/c1-22-14-16-26(17-15-22)21-30(27-11-5-8-23(2)18-27,28-12-6-9-24(3)19-28)29-13-7-10-25(4)20-29;2*1-2(3)4/h5-20H,21H2,1-4H3;2*1H3,(H,3,4)/q+1;;/p-1 |
| InChIKey | VVSQUFPQEQLOQW-UHFFFAOYSA-M |
| XLogP | 5.26 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|