C12H12Na2O4 — CID 168862255
disodium;2-[(3-methylphenyl)methyl]butanedioate (PubChem CID 168862255) has the molecular formula C12H12Na2O4 and a molecular weight of 266.20 g/mol. Its IUPAC name is disodium;2-[(3-methylphenyl)methyl]butanedioate.
| Compound Name | disodium;2-[(3-methylphenyl)methyl]butanedioate |
|---|---|
| PubChem CID | 168862255 |
| Molecular Formula | C12H12Na2O4 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | disodium;2-[(3-methylphenyl)methyl]butanedioate |
| SMILES | Cc1cccc(CC(CC(=O)[O-])C(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C12H14O4.2Na/c1-8-3-2-4-9(5-8)6-10(12(15)16)7-11(13)14;;/h2-5,10H,6-7H2,1H3,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | NEJZJJHGIWRLQN-UHFFFAOYSA-L |
| XLogP | -6.95 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | -6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |