C15H19NaO3 — CID 152966532
sodium 2-benzyl-6-methyl-4-oxoheptanoate (PubChem CID 152966532) has the molecular formula C15H19NaO3 and a molecular weight of 270.30 g/mol. Its IUPAC name is sodium 2-benzyl-6-methyl-4-oxoheptanoate.
| Compound Name | sodium 2-benzyl-6-methyl-4-oxoheptanoate |
|---|---|
| PubChem CID | 152966532 |
| Molecular Formula | C15H19NaO3 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | sodium 2-benzyl-6-methyl-4-oxoheptanoate |
| SMILES | CC(C)CC(=O)CC(Cc1ccccc1)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H20O3.Na/c1-11(2)8-14(16)10-13(15(17)18)9-12-6-4-3-5-7-12;/h3-7,11,13H,8-10H2,1-2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | URPWXZHYFAYAIG-UHFFFAOYSA-M |
| XLogP | -1.40 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |