About 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde
2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde (PubChem CID 21117113) has the molecular formula C24H23O3-
and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde.
Molecular Properties
| Compound Name | 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde |
| PubChem CID | 21117113 |
| Molecular Formula | C24H23O3- |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde |
| SMILES | O=C([O-])C(Cc1ccccc1)Cc1ccccc1.O=CCc1ccccc1 |
| InChI | InChI=1S/C16H16O2.C8H8O/c17-16(18)15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;9-7-6-8-4-2-1-3-5-8/h1-10,15H,11-12H2,(H,17,18);1-5,7H,6H2/p-1 |
| InChIKey | IQWIFTUYGPMZRZ-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde?
The IUPAC name of 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde (CID 21117113) is 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde.
What is the SMILES notation for 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde?
The canonical SMILES for 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde is O=C([O-])C(Cc1ccccc1)Cc1ccccc1.O=CCc1ccccc1.
What is the InChIKey of 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde?
The InChIKey is IQWIFTUYGPMZRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16O2.C8H8O/c17-16(18)15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;9-7-6-8-4-2-1-3-5-8/h1-10,15H,11-12H2,(H,17,18);1-5,7H,6H2/p-1.
What are the key properties of 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde?
2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde has a molecular weight of 359.45 g/mol, XLogP of 3.27, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-phenylpropanoate;2-phenylacetaldehyde is sourced from PubChem (CID 21117113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).