About sodium;hydrogen sulfite;2-phenylacetaldehyde
sodium;hydrogen sulfite;2-phenylacetaldehyde (PubChem CID 158174517) has the molecular formula C8H9NaO4S
and a molecular weight of 224.21 g/mol. Its IUPAC name is sodium;hydrogen sulfite;2-phenylacetaldehyde.
Molecular Properties
| Compound Name | sodium;hydrogen sulfite;2-phenylacetaldehyde |
| PubChem CID | 158174517 |
| Molecular Formula | C8H9NaO4S |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | sodium;hydrogen sulfite;2-phenylacetaldehyde |
| SMILES | O=CCc1ccccc1.O=S([O-])O.[Na+] |
| InChI | InChI=1S/C8H8O.Na.H2O3S/c9-7-6-8-4-2-1-3-5-8;;1-4(2)3/h1-5,7H,6H2;;(H2,1,2,3)/q;+1;/p-1 |
| InChIKey | FXVQFQYXPRYBML-UHFFFAOYSA-M |
| XLogP | -2.23 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydrogen sulfite;2-phenylacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydrogen sulfite;2-phenylacetaldehyde?
The IUPAC name of sodium;hydrogen sulfite;2-phenylacetaldehyde (CID 158174517) is sodium;hydrogen sulfite;2-phenylacetaldehyde.
What is the SMILES notation for sodium;hydrogen sulfite;2-phenylacetaldehyde?
The canonical SMILES for sodium;hydrogen sulfite;2-phenylacetaldehyde is O=CCc1ccccc1.O=S([O-])O.[Na+].
What is the InChIKey of sodium;hydrogen sulfite;2-phenylacetaldehyde?
The InChIKey is FXVQFQYXPRYBML-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O.Na.H2O3S/c9-7-6-8-4-2-1-3-5-8;;1-4(2)3/h1-5,7H,6H2;;(H2,1,2,3)/q;+1;/p-1.
What are the key properties of sodium;hydrogen sulfite;2-phenylacetaldehyde?
sodium;hydrogen sulfite;2-phenylacetaldehyde has a molecular weight of 224.21 g/mol, XLogP of -2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydrogen sulfite;2-phenylacetaldehyde is sourced from PubChem (CID 158174517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).