About sodium;hydride;phenylmethanesulfinate
sodium;hydride;phenylmethanesulfinate (PubChem CID 174980336) has the molecular formula C7H8NaO2S-
and a molecular weight of 179.20 g/mol. Its IUPAC name is sodium;hydride;phenylmethanesulfinate.
Molecular Properties
| Compound Name | sodium;hydride;phenylmethanesulfinate |
| PubChem CID | 174980336 |
| Molecular Formula | C7H8NaO2S- |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | sodium;hydride;phenylmethanesulfinate |
| SMILES | O=S([O-])Cc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C7H8O2S.Na.H/c8-10(9)6-7-4-2-1-3-5-7;;/h1-5H,6H2,(H,8,9);;/q;+1;-1/p-1 |
| InChIKey | MXOYELGNXRJPDI-UHFFFAOYSA-M |
| XLogP | -1.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phenylmethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phenylmethanesulfinate?
The IUPAC name of sodium;hydride;phenylmethanesulfinate (CID 174980336) is sodium;hydride;phenylmethanesulfinate.
What is the SMILES notation for sodium;hydride;phenylmethanesulfinate?
The canonical SMILES for sodium;hydride;phenylmethanesulfinate is O=S([O-])Cc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;phenylmethanesulfinate?
The InChIKey is MXOYELGNXRJPDI-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O2S.Na.H/c8-10(9)6-7-4-2-1-3-5-7;;/h1-5H,6H2,(H,8,9);;/q;+1;-1/p-1.
What are the key properties of sodium;hydride;phenylmethanesulfinate?
sodium;hydride;phenylmethanesulfinate has a molecular weight of 179.20 g/mol, XLogP of -1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phenylmethanesulfinate is sourced from PubChem (CID 174980336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).