About sulfanyl phenylmethanesulfinate
sulfanyl phenylmethanesulfinate (PubChem CID 141352778) has the molecular formula C7H8O2S2
and a molecular weight of 188.27 g/mol. Its IUPAC name is sulfanyl phenylmethanesulfinate.
Molecular Properties
| Compound Name | sulfanyl phenylmethanesulfinate |
| PubChem CID | 141352778 |
| Molecular Formula | C7H8O2S2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | sulfanyl phenylmethanesulfinate |
| SMILES | O=S(Cc1ccccc1)OS |
| InChI | InChI=1S/C7H8O2S2/c8-11(9-10)6-7-4-2-1-3-5-7/h1-5,10H,6H2 |
| InChIKey | ACLZBSUTFPBIBY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl phenylmethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl phenylmethanesulfinate?
The IUPAC name of sulfanyl phenylmethanesulfinate (CID 141352778) is sulfanyl phenylmethanesulfinate.
What is the SMILES notation for sulfanyl phenylmethanesulfinate?
The canonical SMILES for sulfanyl phenylmethanesulfinate is O=S(Cc1ccccc1)OS.
What is the InChIKey of sulfanyl phenylmethanesulfinate?
The InChIKey is ACLZBSUTFPBIBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S2/c8-11(9-10)6-7-4-2-1-3-5-7/h1-5,10H,6H2.
What are the key properties of sulfanyl phenylmethanesulfinate?
sulfanyl phenylmethanesulfinate has a molecular weight of 188.27 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl phenylmethanesulfinate is sourced from PubChem (CID 141352778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).