hydrogen sulfite;phenylsilane

C6H9O3SSi- — CID 175038327

IUPAChydrogen sulfite;phenylsilane
SMILESO=S([O-])O.[SiH3]c1ccccc1
InChIInChI=1S/C6H8Si.H2O3S/c7-6-4-2-1-3-5-6;1-4(2)3/h1-5H,7H3;(H2,1,2,3)/p-1
InChIKeyOWPOMPFOCLDVFL-UHFFFAOYSA-M
MW189.29 g/mol
LogP-0.98
Rot. Bonds

About hydrogen sulfite;phenylsilane

hydrogen sulfite;phenylsilane (PubChem CID 175038327) has the molecular formula C6H9O3SSi- and a molecular weight of 189.29 g/mol. Its IUPAC name is hydrogen sulfite;phenylsilane.

Molecular Properties

Compound Namehydrogen sulfite;phenylsilane
PubChem CID175038327
Molecular FormulaC6H9O3SSi-
Molecular Weight189.29 g/mol
Exact Mass189.00
IUPAC Namehydrogen sulfite;phenylsilane
SMILESO=S([O-])O.[SiH3]c1ccccc1
InChIInChI=1S/C6H8Si.H2O3S/c7-6-4-2-1-3-5-6;1-4(2)3/h1-5H,7H3;(H2,1,2,3)/p-1
InChIKeyOWPOMPFOCLDVFL-UHFFFAOYSA-M
XLogP-0.98
TPSA60.36 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.29
LogP ≤ 5-0.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrogen sulfite;phenylsilane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfite;phenylsilane?
The IUPAC name of hydrogen sulfite;phenylsilane (CID 175038327) is hydrogen sulfite;phenylsilane.
What is the SMILES notation for hydrogen sulfite;phenylsilane?
The canonical SMILES for hydrogen sulfite;phenylsilane is O=S([O-])O.[SiH3]c1ccccc1.
What is the InChIKey of hydrogen sulfite;phenylsilane?
The InChIKey is OWPOMPFOCLDVFL-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8Si.H2O3S/c7-6-4-2-1-3-5-6;1-4(2)3/h1-5H,7H3;(H2,1,2,3)/p-1.
What are the key properties of hydrogen sulfite;phenylsilane?
hydrogen sulfite;phenylsilane has a molecular weight of 189.29 g/mol, XLogP of -0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;phenylsilane is sourced from PubChem (CID 175038327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).