About benzenesulfinic acid;copper
benzenesulfinic acid;copper (PubChem CID 131882722) has the molecular formula C12H12CuO4S2
and a molecular weight of 347.90 g/mol. Its IUPAC name is benzenesulfinic acid;copper.
Molecular Properties
| Compound Name | benzenesulfinic acid;copper |
| PubChem CID | 131882722 |
| Molecular Formula | C12H12CuO4S2 |
| Molecular Weight | 347.90 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | benzenesulfinic acid;copper |
| SMILES | O=S(O)c1ccccc1.O=S(O)c1ccccc1.[Cu] |
| InChI | InChI=1S/2C6H6O2S.Cu/c2*7-9(8)6-4-2-1-3-5-6;/h2*1-5H,(H,7,8); |
| InChIKey | WOSNYHMMLDJHGQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.90 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfinic acid;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfinic acid;copper?
The IUPAC name of benzenesulfinic acid;copper (CID 131882722) is benzenesulfinic acid;copper.
What is the SMILES notation for benzenesulfinic acid;copper?
The canonical SMILES for benzenesulfinic acid;copper is O=S(O)c1ccccc1.O=S(O)c1ccccc1.[Cu].
What is the InChIKey of benzenesulfinic acid;copper?
The InChIKey is WOSNYHMMLDJHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6O2S.Cu/c2*7-9(8)6-4-2-1-3-5-6;/h2*1-5H,(H,7,8);.
What are the key properties of benzenesulfinic acid;copper?
benzenesulfinic acid;copper has a molecular weight of 347.90 g/mol, XLogP of 2.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfinic acid;copper is sourced from PubChem (CID 131882722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).