About sodium;benzenesulfinic acid;fluoride
sodium;benzenesulfinic acid;fluoride (PubChem CID 174567476) has the molecular formula C6H6FNaO2S
and a molecular weight of 184.17 g/mol. Its IUPAC name is sodium;benzenesulfinic acid;fluoride.
Molecular Properties
| Compound Name | sodium;benzenesulfinic acid;fluoride |
| PubChem CID | 174567476 |
| Molecular Formula | C6H6FNaO2S |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | sodium;benzenesulfinic acid;fluoride |
| SMILES | O=S(O)c1ccccc1.[F-].[Na+] |
| InChI | InChI=1S/C6H6O2S.FH.Na/c7-9(8)6-4-2-1-3-5-6;;/h1-5H,(H,7,8);1H;/q;;+1/p-1 |
| InChIKey | FXMRSEMMOBNPMR-UHFFFAOYSA-M |
| XLogP | -4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfinic acid;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfinic acid;fluoride?
The IUPAC name of sodium;benzenesulfinic acid;fluoride (CID 174567476) is sodium;benzenesulfinic acid;fluoride.
What is the SMILES notation for sodium;benzenesulfinic acid;fluoride?
The canonical SMILES for sodium;benzenesulfinic acid;fluoride is O=S(O)c1ccccc1.[F-].[Na+].
What is the InChIKey of sodium;benzenesulfinic acid;fluoride?
The InChIKey is FXMRSEMMOBNPMR-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O2S.FH.Na/c7-9(8)6-4-2-1-3-5-6;;/h1-5H,(H,7,8);1H;/q;;+1/p-1.
What are the key properties of sodium;benzenesulfinic acid;fluoride?
sodium;benzenesulfinic acid;fluoride has a molecular weight of 184.17 g/mol, XLogP of -4.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfinic acid;fluoride is sourced from PubChem (CID 174567476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).