C18H15NO2S — CID 134528275
4-(N-phenylanilino)benzenesulfinic acid (PubChem CID 134528275) has the molecular formula C18H15NO2S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-(N-phenylanilino)benzenesulfinic acid.
| Compound Name | 4-(N-phenylanilino)benzenesulfinic acid |
|---|---|
| PubChem CID | 134528275 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-(N-phenylanilino)benzenesulfinic acid |
| SMILES | O=S(O)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15NO2S/c20-22(21)18-13-11-17(12-14-18)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14H,(H,20,21) |
| InChIKey | IASVXNIGHILSDC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|