C42H34BN3O2 — CID 142746536
[4-[4-(N-phenylanilino)-N-[4-(N-phenylanilino)phenyl]anilino]phenyl]boronic acid (PubChem CID 142746536) has the molecular formula C42H34BN3O2 and a molecular weight of 623.57 g/mol. Its IUPAC name is [4-[4-(N-phenylanilino)-N-[4-(N-phenylanilino)phenyl]anilino]phenyl]boronic acid.
| Compound Name | [4-[4-(N-phenylanilino)-N-[4-(N-phenylanilino)phenyl]anilino]phenyl]boronic acid |
|---|---|
| PubChem CID | 142746536 |
| Molecular Formula | C42H34BN3O2 |
| Molecular Weight | 623.57 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | [4-[4-(N-phenylanilino)-N-[4-(N-phenylanilino)phenyl]anilino]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(N(c2ccc(N(c3ccccc3)c3ccccc3)cc2)c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C42H34BN3O2/c47-43(48)33-21-23-38(24-22-33)46(41-29-25-39(26-30-41)44(34-13-5-1-6-14-34)35-15-7-2-8-16-35)42-31-27-40(28-32-42)45(36-17-9-3-10-18-36)37-19-11-4-12-20-37/h1-32,47-48H |
| InChIKey | HQARLJBPKADAIU-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.57 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|