C36H30BNO2 — CID 174140816
[4-[4-(4-phenylcyclohexa-1,3-dien-1-yl)-N-(4-phenylphenyl)anilino]phenyl]boronic acid (PubChem CID 174140816) has the molecular formula C36H30BNO2 and a molecular weight of 519.45 g/mol. Its IUPAC name is [4-[4-(4-phenylcyclohexa-1,3-dien-1-yl)-N-(4-phenylphenyl)anilino]phenyl]boronic acid.
| Compound Name | [4-[4-(4-phenylcyclohexa-1,3-dien-1-yl)-N-(4-phenylphenyl)anilino]phenyl]boronic acid |
|---|---|
| PubChem CID | 174140816 |
| Molecular Formula | C36H30BNO2 |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | [4-[4-(4-phenylcyclohexa-1,3-dien-1-yl)-N-(4-phenylphenyl)anilino]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(N(c2ccc(C3=CC=C(c4ccccc4)CC3)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H30BNO2/c39-37(40)33-19-25-36(26-20-33)38(34-21-15-31(16-22-34)28-9-5-2-6-10-28)35-23-17-32(18-24-35)30-13-11-29(12-14-30)27-7-3-1-4-8-27/h1-11,13,15-26,39-40H,12,14H2 |
| InChIKey | WHFUJJBUDXBSJP-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|