C36H28BNO2 — CID 171410445
[4-[4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]phenyl]boronic acid (PubChem CID 171410445) has the molecular formula C36H28BNO2 and a molecular weight of 517.44 g/mol. Its IUPAC name is [4-[4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]phenyl]boronic acid.
| Compound Name | [4-[4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 171410445 |
| Molecular Formula | C36H28BNO2 |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | [4-[4-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3cccc(-c4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C36H28BNO2/c39-37(40)33-20-14-29(15-21-33)31-18-24-35(25-19-31)38(34-22-16-30(17-23-34)27-8-3-1-4-9-27)36-13-7-12-32(26-36)28-10-5-2-6-11-28/h1-26,39-40H |
| InChIKey | KPLHOVZLTVYFSC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|