C52H46BBrN2O3 — CID 158399925
N-(4-bromophenyl)-N,4-diphenylaniline;oxolane;[4-(N-(4-phenylphenyl)anilino)phenyl]boronic acid (PubChem CID 158399925) has the molecular formula C52H46BBrN2O3 and a molecular weight of 837.67 g/mol. Its IUPAC name is N-(4-bromophenyl)-N,4-diphenylaniline;oxolane;[4-(N-(4-phenylphenyl)anilino)phenyl]boronic acid.
| Compound Name | N-(4-bromophenyl)-N,4-diphenylaniline;oxolane;[4-(N-(4-phenylphenyl)anilino)phenyl]boronic acid |
|---|---|
| PubChem CID | 158399925 |
| Molecular Formula | C52H46BBrN2O3 |
| Molecular Weight | 837.67 g/mol |
| Exact Mass | 836.28 |
| IUPAC Name | N-(4-bromophenyl)-N,4-diphenylaniline;oxolane;[4-(N-(4-phenylphenyl)anilino)phenyl]boronic acid |
| SMILES | Brc1ccc(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)cc1.C1CCOC1.OB(O)c1ccc(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H20BNO2.C24H18BrN.C4H8O/c27-25(28)21-13-17-24(18-14-21)26(22-9-5-2-6-10-22)23-15-11-20(12-16-23)19-7-3-1-4-8-19;25-21-13-17-24(18-14-21)26(22-9-5-2-6-10-22)23-15-11-20(12-16-23)19-7-3-1-4-8-19;1-2-4-5-3-1/h1-18,27-28H;1-18H;1-4H2 |
| InChIKey | GXZBFLOWLFYNAX-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.67 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|