C24H18BBr3O2 — CID 159137046
1-bromo-4-(4-bromophenyl)benzene;[4-(4-bromophenyl)phenyl]boronic acid (PubChem CID 159137046) has the molecular formula C24H18BBr3O2 and a molecular weight of 588.93 g/mol. Its IUPAC name is 1-bromo-4-(4-bromophenyl)benzene;[4-(4-bromophenyl)phenyl]boronic acid.
| Compound Name | 1-bromo-4-(4-bromophenyl)benzene;[4-(4-bromophenyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 159137046 |
| Molecular Formula | C24H18BBr3O2 |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 585.89 |
| IUPAC Name | 1-bromo-4-(4-bromophenyl)benzene;[4-(4-bromophenyl)phenyl]boronic acid |
| SMILES | Brc1ccc(-c2ccc(Br)cc2)cc1.OB(O)c1ccc(-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C12H10BBrO2.C12H8Br2/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15)16;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8,15-16H;1-8H |
| InChIKey | KHPWENXRERQFOD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|