C14H10BBrF6O2 — CID 159303524
1-bromo-4-(trifluoromethyl)benzene;[4-(trifluoromethyl)phenyl]boronic acid (PubChem CID 159303524) has the molecular formula C14H10BBrF6O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 1-bromo-4-(trifluoromethyl)benzene;[4-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | 1-bromo-4-(trifluoromethyl)benzene;[4-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 159303524 |
| Molecular Formula | C14H10BBrF6O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 1-bromo-4-(trifluoromethyl)benzene;[4-(trifluoromethyl)phenyl]boronic acid |
| SMILES | FC(F)(F)c1ccc(Br)cc1.OB(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C7H6BF3O2.C7H4BrF3/c9-7(10,11)5-1-3-6(4-2-5)8(12)13;8-6-3-1-5(2-4-6)7(9,10)11/h1-4,12-13H;1-4H |
| InChIKey | LBPWGLFNYABVNV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|