About 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid
4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid (PubChem CID 142617993) has the molecular formula C15H18BBrF3NO3
and a molecular weight of 408.02 g/mol. Its IUPAC name is 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid.
Molecular Properties
| Compound Name | 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid |
| PubChem CID | 142617993 |
| Molecular Formula | C15H18BBrF3NO3 |
| Molecular Weight | 408.02 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid |
| SMILES | CC.Nc1ccc(Br)cc1.OB(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C7H6BF3O3.C6H6BrN.C2H6/c9-7(10,11)14-6-3-1-5(2-4-6)8(12)13;7-5-1-3-6(8)4-2-5;1-2/h1-4,12-13H;1-4H,8H2;1-2H3 |
| InChIKey | RCVGSYRXVAEUSC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.02 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid?
The IUPAC name of 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid (CID 142617993) is 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid.
What is the SMILES notation for 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid?
The canonical SMILES for 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid is CC.Nc1ccc(Br)cc1.OB(O)c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid?
The InChIKey is RCVGSYRXVAEUSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BF3O3.C6H6BrN.C2H6/c9-7(10,11)14-6-3-1-5(2-4-6)8(12)13;7-5-1-3-6(8)4-2-5;1-2/h1-4,12-13H;1-4H,8H2;1-2H3.
What are the key properties of 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid?
4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid has a molecular weight of 408.02 g/mol, XLogP of 3.32, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromoaniline;ethane;[4-(trifluoromethoxy)phenyl]boronic acid is sourced from PubChem (CID 142617993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).