About 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene
1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene (PubChem CID 157398822) has the molecular formula C14H9BrF6O2
and a molecular weight of 403.12 g/mol. Its IUPAC name is 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene |
| PubChem CID | 157398822 |
| Molecular Formula | C14H9BrF6O2 |
| Molecular Weight | 403.12 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene |
| SMILES | FC(F)(F)Oc1ccc(Br)cc1.FC(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/C7H4BrF3O.C7H5F3O/c8-5-1-3-6(4-2-5)12-7(9,10)11;8-7(9,10)11-6-4-2-1-3-5-6/h1-4H;1-5H |
| InChIKey | BMXADTFKJJKWOE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.12 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene?
The IUPAC name of 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene (CID 157398822) is 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene.
What is the SMILES notation for 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene?
The canonical SMILES for 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene is FC(F)(F)Oc1ccc(Br)cc1.FC(F)(F)Oc1ccccc1.
What is the InChIKey of 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene?
The InChIKey is BMXADTFKJJKWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrF3O.C7H5F3O/c8-5-1-3-6(4-2-5)12-7(9,10)11;8-7(9,10)11-6-4-2-1-3-5-6/h1-4H;1-5H.
What are the key properties of 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene?
1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene has a molecular weight of 403.12 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(trifluoromethoxy)benzene;trifluoromethoxybenzene is sourced from PubChem (CID 157398822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).