About propan-2-ol;trifluoromethoxybenzene
propan-2-ol;trifluoromethoxybenzene (PubChem CID 161029707) has the molecular formula C10H13F3O2
and a molecular weight of 222.21 g/mol. Its IUPAC name is propan-2-ol;trifluoromethoxybenzene.
Molecular Properties
| Compound Name | propan-2-ol;trifluoromethoxybenzene |
| PubChem CID | 161029707 |
| Molecular Formula | C10H13F3O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | propan-2-ol;trifluoromethoxybenzene |
| SMILES | CC(C)O.FC(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/C7H5F3O.C3H8O/c8-7(9,10)11-6-4-2-1-3-5-6;1-3(2)4/h1-5H;3-4H,1-2H3 |
| InChIKey | TZLFFOUOJMPBDI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-ol;trifluoromethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;trifluoromethoxybenzene?
The IUPAC name of propan-2-ol;trifluoromethoxybenzene (CID 161029707) is propan-2-ol;trifluoromethoxybenzene.
What is the SMILES notation for propan-2-ol;trifluoromethoxybenzene?
The canonical SMILES for propan-2-ol;trifluoromethoxybenzene is CC(C)O.FC(F)(F)Oc1ccccc1.
What is the InChIKey of propan-2-ol;trifluoromethoxybenzene?
The InChIKey is TZLFFOUOJMPBDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3O.C3H8O/c8-7(9,10)11-6-4-2-1-3-5-6;1-3(2)4/h1-5H;3-4H,1-2H3.
What are the key properties of propan-2-ol;trifluoromethoxybenzene?
propan-2-ol;trifluoromethoxybenzene has a molecular weight of 222.21 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;trifluoromethoxybenzene is sourced from PubChem (CID 161029707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).