About 1-chloropentane;sulfane;trifluoromethoxybenzene
1-chloropentane;sulfane;trifluoromethoxybenzene (PubChem CID 174892257) has the molecular formula C12H18ClF3OS
and a molecular weight of 302.79 g/mol. Its IUPAC name is 1-chloropentane;sulfane;trifluoromethoxybenzene.
Molecular Properties
| Compound Name | 1-chloropentane;sulfane;trifluoromethoxybenzene |
| PubChem CID | 174892257 |
| Molecular Formula | C12H18ClF3OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-chloropentane;sulfane;trifluoromethoxybenzene |
| SMILES | CCCCCCl.FC(F)(F)Oc1ccccc1.S |
| InChI | InChI=1S/C7H5F3O.C5H11Cl.H2S/c8-7(9,10)11-6-4-2-1-3-5-6;1-2-3-4-5-6;/h1-5H;2-5H2,1H3;1H2 |
| InChIKey | CEKZGSJDPJXRNU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;sulfane;trifluoromethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;sulfane;trifluoromethoxybenzene?
The IUPAC name of 1-chloropentane;sulfane;trifluoromethoxybenzene (CID 174892257) is 1-chloropentane;sulfane;trifluoromethoxybenzene.
What is the SMILES notation for 1-chloropentane;sulfane;trifluoromethoxybenzene?
The canonical SMILES for 1-chloropentane;sulfane;trifluoromethoxybenzene is CCCCCCl.FC(F)(F)Oc1ccccc1.S.
What is the InChIKey of 1-chloropentane;sulfane;trifluoromethoxybenzene?
The InChIKey is CEKZGSJDPJXRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3O.C5H11Cl.H2S/c8-7(9,10)11-6-4-2-1-3-5-6;1-2-3-4-5-6;/h1-5H;2-5H2,1H3;1H2.
What are the key properties of 1-chloropentane;sulfane;trifluoromethoxybenzene?
1-chloropentane;sulfane;trifluoromethoxybenzene has a molecular weight of 302.79 g/mol, XLogP of 5.11, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;sulfane;trifluoromethoxybenzene is sourced from PubChem (CID 174892257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).