About hexane;1-methyl-3-(trifluoromethoxy)benzene
hexane;1-methyl-3-(trifluoromethoxy)benzene (PubChem CID 143689144) has the molecular formula C14H21F3O
and a molecular weight of 262.31 g/mol. Its IUPAC name is hexane;1-methyl-3-(trifluoromethoxy)benzene.
Molecular Properties
| Compound Name | hexane;1-methyl-3-(trifluoromethoxy)benzene |
| PubChem CID | 143689144 |
| Molecular Formula | C14H21F3O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | hexane;1-methyl-3-(trifluoromethoxy)benzene |
| SMILES | CCCCCC.Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C8H7F3O.C6H14/c1-6-3-2-4-7(5-6)12-8(9,10)11;1-3-5-6-4-2/h2-5H,1H3;3-6H2,1-2H3 |
| InChIKey | ZTMAXKGBEZYYKU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;1-methyl-3-(trifluoromethoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;1-methyl-3-(trifluoromethoxy)benzene?
The IUPAC name of hexane;1-methyl-3-(trifluoromethoxy)benzene (CID 143689144) is hexane;1-methyl-3-(trifluoromethoxy)benzene.
What is the SMILES notation for hexane;1-methyl-3-(trifluoromethoxy)benzene?
The canonical SMILES for hexane;1-methyl-3-(trifluoromethoxy)benzene is CCCCCC.Cc1cccc(OC(F)(F)F)c1.
What is the InChIKey of hexane;1-methyl-3-(trifluoromethoxy)benzene?
The InChIKey is ZTMAXKGBEZYYKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O.C6H14/c1-6-3-2-4-7(5-6)12-8(9,10)11;1-3-5-6-4-2/h2-5H,1H3;3-6H2,1-2H3.
What are the key properties of hexane;1-methyl-3-(trifluoromethoxy)benzene?
hexane;1-methyl-3-(trifluoromethoxy)benzene has a molecular weight of 262.31 g/mol, XLogP of 5.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;1-methyl-3-(trifluoromethoxy)benzene is sourced from PubChem (CID 143689144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).