C13H17F3O — CID 123947966
1-hexan-2-yl-3-(trifluoromethoxy)benzene (PubChem CID 123947966) has the molecular formula C13H17F3O and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-hexan-2-yl-3-(trifluoromethoxy)benzene.
| Compound Name | 1-hexan-2-yl-3-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 123947966 |
| Molecular Formula | C13H17F3O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-hexan-2-yl-3-(trifluoromethoxy)benzene |
| SMILES | CCCCC(C)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3O/c1-3-4-6-10(2)11-7-5-8-12(9-11)17-13(14,15)16/h5,7-10H,3-4,6H2,1-2H3 |
| InChIKey | FHFOTYGSUQBRQL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |