C12H17ClF3NO — CID 171229785
(1S)-1-[3-(trifluoromethoxy)phenyl]pentan-1-amine;hydrochloride (PubChem CID 171229785) has the molecular formula C12H17ClF3NO and a molecular weight of 283.72 g/mol. Its IUPAC name is (1S)-1-[3-(trifluoromethoxy)phenyl]pentan-1-amine;hydrochloride.
| Compound Name | (1S)-1-[3-(trifluoromethoxy)phenyl]pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171229785 |
| Molecular Formula | C12H17ClF3NO |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (1S)-1-[3-(trifluoromethoxy)phenyl]pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@H](N)c1cccc(OC(F)(F)F)c1.Cl |
| InChI | InChI=1S/C12H16F3NO.ClH/c1-2-3-7-11(16)9-5-4-6-10(8-9)17-12(13,14)15;/h4-6,8,11H,2-3,7,16H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | LBVSSEXZKQHKSA-MERQFXBCSA-N |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |