C13H18F3NO — CID 94895047
(1S)-4-methyl-1-[3-(trifluoromethoxy)phenyl]pentan-1-amine (PubChem CID 94895047) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is (1S)-4-methyl-1-[3-(trifluoromethoxy)phenyl]pentan-1-amine.
| Compound Name | (1S)-4-methyl-1-[3-(trifluoromethoxy)phenyl]pentan-1-amine |
|---|---|
| PubChem CID | 94895047 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (1S)-4-methyl-1-[3-(trifluoromethoxy)phenyl]pentan-1-amine |
| SMILES | CC(C)CC[C@H](N)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO/c1-9(2)6-7-12(17)10-4-3-5-11(8-10)18-13(14,15)16/h3-5,8-9,12H,6-7,17H2,1-2H3/t12-/m0/s1 |
| InChIKey | FOBVHJKOCZZDJJ-LBPRGKRZSA-N |
| XLogP | 4.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |