C14H20F3NO2 — CID 171264181
(1R,2S)-1-amino-5-methyl-1-[3-(trifluoromethoxy)phenyl]hexan-2-ol (PubChem CID 171264181) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is (1R,2S)-1-amino-5-methyl-1-[3-(trifluoromethoxy)phenyl]hexan-2-ol.
| Compound Name | (1R,2S)-1-amino-5-methyl-1-[3-(trifluoromethoxy)phenyl]hexan-2-ol |
|---|---|
| PubChem CID | 171264181 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (1R,2S)-1-amino-5-methyl-1-[3-(trifluoromethoxy)phenyl]hexan-2-ol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NO2/c1-9(2)6-7-12(19)13(18)10-4-3-5-11(8-10)20-14(15,16)17/h3-5,8-9,12-13,19H,6-7,18H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | BJIUROWPNKRQEC-QWHCGFSZSA-N |
| XLogP | 3.38 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |