C13H21NO2 — CID 171260899
3-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]phenol (PubChem CID 171260899) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]phenol.
| Compound Name | 3-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]phenol |
|---|---|
| PubChem CID | 171260899 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 3-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]phenol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1cccc(O)c1 |
| InChI | InChI=1S/C13H21NO2/c1-9(2)6-7-12(16)13(14)10-4-3-5-11(15)8-10/h3-5,8-9,12-13,15-16H,6-7,14H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | OFLBFZFBTBPBJG-QWHCGFSZSA-N |
| XLogP | 2.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |