C13H19I2NO2 — CID 171265966
4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2,6-diiodophenol (PubChem CID 171265966) has the molecular formula C13H19I2NO2 and a molecular weight of 475.11 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2,6-diiodophenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2,6-diiodophenol |
|---|---|
| PubChem CID | 171265966 |
| Molecular Formula | C13H19I2NO2 |
| Molecular Weight | 475.11 g/mol |
| Exact Mass | 474.95 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2,6-diiodophenol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C13H19I2NO2/c1-7(2)3-4-11(17)12(16)8-5-9(14)13(18)10(15)6-8/h5-7,11-12,17-18H,3-4,16H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | UIJBSHCFZPYKID-NWDGAFQWSA-N |
| XLogP | 3.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.11 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|