C14H22ClNO3 — CID 171265755
4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-chloro-6-methoxyphenol (PubChem CID 171265755) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-chloro-6-methoxyphenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-chloro-6-methoxyphenol |
|---|---|
| PubChem CID | 171265755 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]-2-chloro-6-methoxyphenol |
| SMILES | COc1cc([C@@H](N)[C@@H](O)CCC(C)C)cc(Cl)c1O |
| InChI | InChI=1S/C14H22ClNO3/c1-8(2)4-5-11(17)13(16)9-6-10(15)14(18)12(7-9)19-3/h6-8,11,13,17-18H,4-5,16H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | GJVNYQQXRZVXPP-WCQYABFASA-N |
| XLogP | 2.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |