C14H24ClNO3 — CID 171219344
4-[(1S)-1-amino-4-methylpentyl]-2,6-dimethoxyphenol;hydrochloride (PubChem CID 171219344) has the molecular formula C14H24ClNO3 and a molecular weight of 289.80 g/mol. Its IUPAC name is 4-[(1S)-1-amino-4-methylpentyl]-2,6-dimethoxyphenol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-4-methylpentyl]-2,6-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171219344 |
| Molecular Formula | C14H24ClNO3 |
| Molecular Weight | 289.80 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-[(1S)-1-amino-4-methylpentyl]-2,6-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc([C@@H](N)CCC(C)C)cc(OC)c1O.Cl |
| InChI | InChI=1S/C14H23NO3.ClH/c1-9(2)5-6-11(15)10-7-12(17-3)14(16)13(8-10)18-4;/h7-9,11,16H,5-6,15H2,1-4H3;1H/t11-;/m0./s1 |
| InChIKey | DVKUNHKBHWHHHH-MERQFXBCSA-N |
| XLogP | 3.27 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |