C14H22ClNO2 — CID 62601776
1-(3-chloro-4,5-dimethoxyphenyl)-4-methylpentan-1-amine (PubChem CID 62601776) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 1-(3-chloro-4,5-dimethoxyphenyl)-4-methylpentan-1-amine.
| Compound Name | 1-(3-chloro-4,5-dimethoxyphenyl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 62601776 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-(3-chloro-4,5-dimethoxyphenyl)-4-methylpentan-1-amine |
| SMILES | COc1cc(C(N)CCC(C)C)cc(Cl)c1OC |
| InChI | InChI=1S/C14H22ClNO2/c1-9(2)5-6-12(16)10-7-11(15)14(18-4)13(8-10)17-3/h7-9,12H,5-6,16H2,1-4H3 |
| InChIKey | WXZMTPRTFHEZPR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |