C13H21BrClNO2 — CID 171226160
4-[(1S)-1-amino-4-methylpentyl]-2-bromo-6-methoxyphenol;hydrochloride (PubChem CID 171226160) has the molecular formula C13H21BrClNO2 and a molecular weight of 338.67 g/mol. Its IUPAC name is 4-[(1S)-1-amino-4-methylpentyl]-2-bromo-6-methoxyphenol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-4-methylpentyl]-2-bromo-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171226160 |
| Molecular Formula | C13H21BrClNO2 |
| Molecular Weight | 338.67 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 4-[(1S)-1-amino-4-methylpentyl]-2-bromo-6-methoxyphenol;hydrochloride |
| SMILES | COc1cc([C@@H](N)CCC(C)C)cc(Br)c1O.Cl |
| InChI | InChI=1S/C13H20BrNO2.ClH/c1-8(2)4-5-11(15)9-6-10(14)13(16)12(7-9)17-3;/h6-8,11,16H,4-5,15H2,1-3H3;1H/t11-;/m0./s1 |
| InChIKey | AANIYUIBZMDRPU-MERQFXBCSA-N |
| XLogP | 4.02 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |