C12H17BrClNO2 — CID 171206582
4-[(1R)-1-amino-3-methylbut-3-enyl]-2-bromo-6-methoxyphenol;hydrochloride (PubChem CID 171206582) has the molecular formula C12H17BrClNO2 and a molecular weight of 322.63 g/mol. Its IUPAC name is 4-[(1R)-1-amino-3-methylbut-3-enyl]-2-bromo-6-methoxyphenol;hydrochloride.
| Compound Name | 4-[(1R)-1-amino-3-methylbut-3-enyl]-2-bromo-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171206582 |
| Molecular Formula | C12H17BrClNO2 |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 4-[(1R)-1-amino-3-methylbut-3-enyl]-2-bromo-6-methoxyphenol;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1cc(Br)c(O)c(OC)c1.Cl |
| InChI | InChI=1S/C12H16BrNO2.ClH/c1-7(2)4-10(14)8-5-9(13)12(15)11(6-8)16-3;/h5-6,10,15H,1,4,14H2,2-3H3;1H/t10-;/m1./s1 |
| InChIKey | XDLSAXUOKYLQBL-HNCPQSOCSA-N |
| XLogP | 3.55 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|