C9H10BrF2NO2 — CID 130062366
4-(1-amino-2,2-difluoroethyl)-2-bromo-6-methoxyphenol (PubChem CID 130062366) has the molecular formula C9H10BrF2NO2 and a molecular weight of 282.08 g/mol. Its IUPAC name is 4-(1-amino-2,2-difluoroethyl)-2-bromo-6-methoxyphenol.
| Compound Name | 4-(1-amino-2,2-difluoroethyl)-2-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 130062366 |
| Molecular Formula | C9H10BrF2NO2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 4-(1-amino-2,2-difluoroethyl)-2-bromo-6-methoxyphenol |
| SMILES | COc1cc(C(N)C(F)F)cc(Br)c1O |
| InChI | InChI=1S/C9H10BrF2NO2/c1-15-6-3-4(7(13)9(11)12)2-5(10)8(6)14/h2-3,7,9,14H,13H2,1H3 |
| InChIKey | WWTHFEUIDTXIDM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |