C9H9BrF3NO2 — CID 66512189
4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-bromo-6-methoxyphenol (PubChem CID 66512189) has the molecular formula C9H9BrF3NO2 and a molecular weight of 300.07 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-bromo-6-methoxyphenol.
| Compound Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 66512189 |
| Molecular Formula | C9H9BrF3NO2 |
| Molecular Weight | 300.07 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-bromo-6-methoxyphenol |
| SMILES | COc1cc([C@H](N)C(F)(F)F)cc(Br)c1O |
| InChI | InChI=1S/C9H9BrF3NO2/c1-16-6-3-4(2-5(10)7(6)15)8(14)9(11,12)13/h2-3,8,15H,14H2,1H3/t8-/m0/s1 |
| InChIKey | BQASXSKRTRDYCJ-QMMMGPOBSA-N |
| XLogP | 2.73 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.07 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |