C11H14F3NO3 — CID 66512237
(1S)-2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethanamine (PubChem CID 66512237) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66512237 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethanamine |
| SMILES | COc1cc([C@H](N)C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C11H14F3NO3/c1-16-7-4-6(10(15)11(12,13)14)5-8(17-2)9(7)18-3/h4-5,10H,15H2,1-3H3/t10-/m0/s1 |
| InChIKey | DTMMWTIWVAGCLH-JTQLQIEISA-N |
| XLogP | 2.27 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |